C28H23F2N7O3 — CID 44555792
1-[7-[3-(1,1-difluoroethyl)-1,2,4-triazol-1-yl]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)ethane-1,2-dione (PubChem CID 44555792) has the molecular formula C28H23F2N7O3 and a molecular weight of 543.53 g/mol. Its IUPAC name is 1-[7-[3-(1,1-difluoroethyl)-1,2,4-triazol-1-yl]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)ethane-1,2-dione.
| Compound Name | 1-[7-[3-(1,1-difluoroethyl)-1,2,4-triazol-1-yl]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 44555792 |
| Molecular Formula | C28H23F2N7O3 |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 1-[7-[3-(1,1-difluoroethyl)-1,2,4-triazol-1-yl]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)ethane-1,2-dione |
| SMILES | COc1cnc(-n2cnc(C(C)(F)F)n2)c2[nH]cc(C(=O)C(=O)N3CCc4c(cccc4-c4ccccn4)C3)c12 |
| InChI | InChI=1S/C28H23F2N7O3/c1-28(29,30)27-34-15-37(35-27)25-23-22(21(40-2)13-33-25)19(12-32-23)24(38)26(39)36-11-9-17-16(14-36)6-5-7-18(17)20-8-3-4-10-31-20/h3-8,10,12-13,15,32H,9,11,14H2,1-2H3 |
| InChIKey | KPXRUZGARFIXBL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|