C20H15F9N4O4 — CID 44555845
bis(2,2,2-trifluoroacetic acid);(11R,12R)-11-(2,4,5-trifluorophenyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine (PubChem CID 44555845) has the molecular formula C20H15F9N4O4 and a molecular weight of 546.35 g/mol. Its IUPAC name is bis(2,2,2-trifluoroacetic acid);(11R,12R)-11-(2,4,5-trifluorophenyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine.
| Compound Name | bis(2,2,2-trifluoroacetic acid);(11R,12R)-11-(2,4,5-trifluorophenyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine |
|---|---|
| PubChem CID | 44555845 |
| Molecular Formula | C20H15F9N4O4 |
| Molecular Weight | 546.35 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | bis(2,2,2-trifluoroacetic acid);(11R,12R)-11-(2,4,5-trifluorophenyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine |
| SMILES | N[C@H]1Cn2c(nc3cnccc32)C[C@@H]1c1cc(F)c(F)cc1F.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H13F3N4.2C2HF3O2/c17-10-5-12(19)11(18)3-8(10)9-4-16-22-14-6-21-2-1-15(14)23(16)7-13(9)20;2*3-2(4,5)1(6)7/h1-3,5-6,9,13H,4,7,20H2;2*(H,6,7)/t9-,13+;;/m1../s1 |
| InChIKey | OJOTVCSJHUDVKC-OIYPRRECSA-N |
| XLogP | 3.78 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|