C23H34N4O4S — CID 44555937
N-(2-cyclohexylethyl)-6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]hexane-1-sulfonamide (PubChem CID 44555937) has the molecular formula C23H34N4O4S and a molecular weight of 462.62 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]hexane-1-sulfonamide.
| Compound Name | N-(2-cyclohexylethyl)-6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]hexane-1-sulfonamide |
|---|---|
| PubChem CID | 44555937 |
| Molecular Formula | C23H34N4O4S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-(2-cyclohexylethyl)-6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]hexane-1-sulfonamide |
| SMILES | O=c1c(NCCCCCCS(=O)(=O)NCCC2CCCCC2)c(Nc2ccncc2)c1=O |
| InChI | InChI=1S/C23H34N4O4S/c28-22-20(21(23(22)29)27-19-11-14-24-15-12-19)25-13-6-1-2-7-17-32(30,31)26-16-10-18-8-4-3-5-9-18/h11-12,14-15,18,25-26H,1-10,13,16-17H2,(H,24,27) |
| InChIKey | QXFQTKHFORPSNA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|