About [[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-methyl-oxo-λ6-sulfanylidene]cyanamide
[[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-methyl-oxo-λ6-sulfanylidene]cyanamide (PubChem CID 44555954) has the molecular formula C7H9ClN4OS2
and a molecular weight of 264.76 g/mol. Its IUPAC name is [[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-methyl-oxo-λ6-sulfanylidene]cyanamide.
Molecular Properties
| Compound Name | [[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-methyl-oxo-λ6-sulfanylidene]cyanamide |
| PubChem CID | 44555954 |
| Molecular Formula | C7H9ClN4OS2 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | [[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-methyl-oxo-λ6-sulfanylidene]cyanamide |
| SMILES | CN(Cc1cnc(Cl)s1)S(C)(=O)=NC#N |
| InChI | InChI=1S/C7H9ClN4OS2/c1-12(15(2,13)11-5-9)4-6-3-10-7(8)14-6/h3H,4H2,1-2H3 |
| InChIKey | GLJNITFWTOZOPJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 69.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-methyl-oxo-λ6-sulfanylidene]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-methyl-oxo-λ6-sulfanylidene]cyanamide?
The IUPAC name of [[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-methyl-oxo-λ6-sulfanylidene]cyanamide (CID 44555954) is [[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-methyl-oxo-λ6-sulfanylidene]cyanamide.
What is the SMILES notation for [[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-methyl-oxo-λ6-sulfanylidene]cyanamide?
The canonical SMILES for [[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-methyl-oxo-λ6-sulfanylidene]cyanamide is CN(Cc1cnc(Cl)s1)S(C)(=O)=NC#N.
What is the InChIKey of [[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-methyl-oxo-λ6-sulfanylidene]cyanamide?
The InChIKey is GLJNITFWTOZOPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN4OS2/c1-12(15(2,13)11-5-9)4-6-3-10-7(8)14-6/h3H,4H2,1-2H3.
What are the key properties of [[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-methyl-oxo-λ6-sulfanylidene]cyanamide?
[[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-methyl-oxo-λ6-sulfanylidene]cyanamide has a molecular weight of 264.76 g/mol, XLogP of 1.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-methyl-oxo-λ6-sulfanylidene]cyanamide is sourced from PubChem (CID 44555954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).