C26H27F2N5O2 — CID 44555961
(E)-1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[[2-(2-methoxy-4-pyridinyl)-2,6-diazaspiro[3.3]heptan-6-yl]methyl]-2-pyridinyl]methanimine (PubChem CID 44555961) has the molecular formula C26H27F2N5O2 and a molecular weight of 479.53 g/mol. Its IUPAC name is (E)-1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[[2-(2-methoxy-4-pyridinyl)-2,6-diazaspiro[3.3]heptan-6-yl]methyl]-2-pyridinyl]methanimine.
| Compound Name | (E)-1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[[2-(2-methoxy-4-pyridinyl)-2,6-diazaspiro[3.3]heptan-6-yl]methyl]-2-pyridinyl]methanimine |
|---|---|
| PubChem CID | 44555961 |
| Molecular Formula | C26H27F2N5O2 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (E)-1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[[2-(2-methoxy-4-pyridinyl)-2,6-diazaspiro[3.3]heptan-6-yl]methyl]-2-pyridinyl]methanimine |
| SMILES | CCO/N=C(\c1ccc(F)c(F)c1)c1ccc(CN2CC3(C2)CN(c2ccnc(OC)c2)C3)cn1 |
| InChI | InChI=1S/C26H27F2N5O2/c1-3-35-31-25(19-5-6-21(27)22(28)10-19)23-7-4-18(12-30-23)13-32-14-26(15-32)16-33(17-26)20-8-9-29-24(11-20)34-2/h4-12H,3,13-17H2,1-2H3/b31-25+ |
| InChIKey | JRNLDUXZGINBQI-QCKNELIISA-N |
| XLogP | 3.87 |
| TPSA | 63.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|