C20H28F3N5O — CID 44556207
3-[[(2S)-1-methylazetidin-2-yl]methoxy]-5-[4-(7,7,7-trifluoro-2-methylheptan-2-yl)triazol-1-yl]pyridine (PubChem CID 44556207) has the molecular formula C20H28F3N5O and a molecular weight of 411.47 g/mol. Its IUPAC name is 3-[[(2S)-1-methylazetidin-2-yl]methoxy]-5-[4-(7,7,7-trifluoro-2-methylheptan-2-yl)triazol-1-yl]pyridine.
| Compound Name | 3-[[(2S)-1-methylazetidin-2-yl]methoxy]-5-[4-(7,7,7-trifluoro-2-methylheptan-2-yl)triazol-1-yl]pyridine |
|---|---|
| PubChem CID | 44556207 |
| Molecular Formula | C20H28F3N5O |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 3-[[(2S)-1-methylazetidin-2-yl]methoxy]-5-[4-(7,7,7-trifluoro-2-methylheptan-2-yl)triazol-1-yl]pyridine |
| SMILES | CN1CC[C@H]1COc1cncc(-n2cc(C(C)(C)CCCCC(F)(F)F)nn2)c1 |
| InChI | InChI=1S/C20H28F3N5O/c1-19(2,7-4-5-8-20(21,22)23)18-13-28(26-25-18)16-10-17(12-24-11-16)29-14-15-6-9-27(15)3/h10-13,15H,4-9,14H2,1-3H3/t15-/m0/s1 |
| InChIKey | LPRGUELNDXLUBC-HNNXBMFYSA-N |
| XLogP | 4.15 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|