About [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate
[(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate (PubChem CID 44556691) has the molecular formula C16H28O6
and a molecular weight of 316.39 g/mol. Its IUPAC name is [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate.
Molecular Properties
| Compound Name | [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate |
| PubChem CID | 44556691 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate |
| SMILES | C=CCC(O)CC(=O)O[C@H](C)C[C@@H](C=C)OCOCCOC |
| InChI | InChI=1S/C16H28O6/c1-5-7-14(17)11-16(18)22-13(3)10-15(6-2)21-12-20-9-8-19-4/h5-6,13-15,17H,1-2,7-12H2,3-4H3/t13-,14?,15-/m1/s1 |
| InChIKey | NAMVOMXRYJHLLH-GIJJTGMTSA-N |
| XLogP | 1.83 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate?
The IUPAC name of [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate (CID 44556691) is [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate.
What is the SMILES notation for [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate?
The canonical SMILES for [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate is C=CCC(O)CC(=O)O[C@H](C)C[C@@H](C=C)OCOCCOC.
What is the InChIKey of [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate?
The InChIKey is NAMVOMXRYJHLLH-GIJJTGMTSA-N. The full InChI is InChI=1S/C16H28O6/c1-5-7-14(17)11-16(18)22-13(3)10-15(6-2)21-12-20-9-8-19-4/h5-6,13-15,17H,1-2,7-12H2,3-4H3/t13-,14?,15-/m1/s1.
What are the key properties of [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate?
[(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate has a molecular weight of 316.39 g/mol, XLogP of 1.83, 14 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate is sourced from PubChem (CID 44556691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).