C16H28O6 — CID 44556691
[(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate (PubChem CID 44556691) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate.
| Compound Name | [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate |
|---|---|
| PubChem CID | 44556691 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | [(2R,4S)-4-(2-methoxyethoxymethoxy)hex-5-en-2-yl] 3-hydroxyhex-5-enoate |
| SMILES | C=CCC(O)CC(=O)O[C@H](C)C[C@@H](C=C)OCOCCOC |
| InChI | InChI=1S/C16H28O6/c1-5-7-14(17)11-16(18)22-13(3)10-15(6-2)21-12-20-9-8-19-4/h5-6,13-15,17H,1-2,7-12H2,3-4H3/t13-,14?,15-/m1/s1 |
| InChIKey | NAMVOMXRYJHLLH-GIJJTGMTSA-N |
| XLogP | 1.83 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|