C40H62O5Si2 — CID 44556791
[(2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,3S)-3-ethenyloxiran-2-yl]-5-methylhexan-2-yl] (3S)-3-methylhex-5-enoate (PubChem CID 44556791) has the molecular formula C40H62O5Si2 and a molecular weight of 679.10 g/mol. Its IUPAC name is [(2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,3S)-3-ethenyloxiran-2-yl]-5-methylhexan-2-yl] (3S)-3-methylhex-5-enoate.
| Compound Name | [(2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,3S)-3-ethenyloxiran-2-yl]-5-methylhexan-2-yl] (3S)-3-methylhex-5-enoate |
|---|---|
| PubChem CID | 44556791 |
| Molecular Formula | C40H62O5Si2 |
| Molecular Weight | 679.10 g/mol |
| Exact Mass | 678.41 |
| IUPAC Name | [(2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,3S)-3-ethenyloxiran-2-yl]-5-methylhexan-2-yl] (3S)-3-methylhex-5-enoate |
| SMILES | C=CC[C@H](C)CC(=O)O[C@@H](C[C@@H]1O[C@H]1C=C)[C@H](C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H62O5Si2/c1-13-21-30(3)27-38(41)44-36(28-35-34(14-2)43-35)37(45-46(11,12)39(5,6)7)26-31(4)29-42-47(40(8,9)10,32-22-17-15-18-23-32)33-24-19-16-20-25-33/h13-20,22-25,30-31,34-37H,1-2,21,26-29H2,3-12H3/t30-,31+,34-,35-,36-,37-/m0/s1 |
| InChIKey | WORZWHWSGRNTDU-KSZJPVAXSA-N |
| XLogP | 8.84 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.10 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|