About (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-ol
(3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-ol (PubChem CID 44556792) has the molecular formula C12H24O2Si
and a molecular weight of 228.41 g/mol. Its IUPAC name is (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-ol.
Molecular Properties
| Compound Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-ol |
| PubChem CID | 44556792 |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-ol |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)C=C |
| InChI | InChI=1S/C12H24O2Si/c1-8-10(13)11(9-2)14-15(6,7)12(3,4)5/h8-11,13H,1-2H2,3-7H3/t10-,11-/m0/s1 |
| InChIKey | DQIGJTSGNQMRCQ-QWRGUYRKSA-N |
| XLogP | 3.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-ol?
The IUPAC name of (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-ol (CID 44556792) is (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-ol.
What is the SMILES notation for (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-ol?
The canonical SMILES for (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-ol is C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)C=C.
What is the InChIKey of (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-ol?
The InChIKey is DQIGJTSGNQMRCQ-QWRGUYRKSA-N. The full InChI is InChI=1S/C12H24O2Si/c1-8-10(13)11(9-2)14-15(6,7)12(3,4)5/h8-11,13H,1-2H2,3-7H3/t10-,11-/m0/s1.
What are the key properties of (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-ol?
(3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-ol has a molecular weight of 228.41 g/mol, XLogP of 3.11, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-ol is sourced from PubChem (CID 44556792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).