About 5-[2-(diethylamino)ethyl]-8,9-dimethoxybenzo[c][1,8]phenanthrolin-6-one
5-[2-(diethylamino)ethyl]-8,9-dimethoxybenzo[c][1,8]phenanthrolin-6-one (PubChem CID 44556933) has the molecular formula C24H27N3O3
and a molecular weight of 405.50 g/mol. Its IUPAC name is 5-[2-(diethylamino)ethyl]-8,9-dimethoxybenzo[c][1,8]phenanthrolin-6-one.
Molecular Properties
| Compound Name | 5-[2-(diethylamino)ethyl]-8,9-dimethoxybenzo[c][1,8]phenanthrolin-6-one |
| PubChem CID | 44556933 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 5-[2-(diethylamino)ethyl]-8,9-dimethoxybenzo[c][1,8]phenanthrolin-6-one |
| SMILES | CCN(CC)CCn1c(=O)c2cc(OC)c(OC)cc2c2ccc3cnccc3c21 |
| InChI | InChI=1S/C24H27N3O3/c1-5-26(6-2)11-12-27-23-17-9-10-25-15-16(17)7-8-18(23)19-13-21(29-3)22(30-4)14-20(19)24(27)28/h7-10,13-15H,5-6,11-12H2,1-4H3 |
| InChIKey | JJDNEZWMMJNLGF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(diethylamino)ethyl]-8,9-dimethoxybenzo[c][1,8]phenanthrolin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(diethylamino)ethyl]-8,9-dimethoxybenzo[c][1,8]phenanthrolin-6-one?
The IUPAC name of 5-[2-(diethylamino)ethyl]-8,9-dimethoxybenzo[c][1,8]phenanthrolin-6-one (CID 44556933) is 5-[2-(diethylamino)ethyl]-8,9-dimethoxybenzo[c][1,8]phenanthrolin-6-one.
What is the SMILES notation for 5-[2-(diethylamino)ethyl]-8,9-dimethoxybenzo[c][1,8]phenanthrolin-6-one?
The canonical SMILES for 5-[2-(diethylamino)ethyl]-8,9-dimethoxybenzo[c][1,8]phenanthrolin-6-one is CCN(CC)CCn1c(=O)c2cc(OC)c(OC)cc2c2ccc3cnccc3c21.
What is the InChIKey of 5-[2-(diethylamino)ethyl]-8,9-dimethoxybenzo[c][1,8]phenanthrolin-6-one?
The InChIKey is JJDNEZWMMJNLGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N3O3/c1-5-26(6-2)11-12-27-23-17-9-10-25-15-16(17)7-8-18(23)19-13-21(29-3)22(30-4)14-20(19)24(27)28/h7-10,13-15H,5-6,11-12H2,1-4H3.
What are the key properties of 5-[2-(diethylamino)ethyl]-8,9-dimethoxybenzo[c][1,8]phenanthrolin-6-one?
5-[2-(diethylamino)ethyl]-8,9-dimethoxybenzo[c][1,8]phenanthrolin-6-one has a molecular weight of 405.50 g/mol, XLogP of 4.06, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(diethylamino)ethyl]-8,9-dimethoxybenzo[c][1,8]phenanthrolin-6-one is sourced from PubChem (CID 44556933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).