C18H16Cl2FNO — CID 44556937
N-[4,4-bis(4-chlorophenyl)-3-fluorobut-3-enyl]acetamide (PubChem CID 44556937) has the molecular formula C18H16Cl2FNO and a molecular weight of 352.24 g/mol. Its IUPAC name is N-[4,4-bis(4-chlorophenyl)-3-fluorobut-3-enyl]acetamide.
| Compound Name | N-[4,4-bis(4-chlorophenyl)-3-fluorobut-3-enyl]acetamide |
|---|---|
| PubChem CID | 44556937 |
| Molecular Formula | C18H16Cl2FNO |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | N-[4,4-bis(4-chlorophenyl)-3-fluorobut-3-enyl]acetamide |
| SMILES | CC(=O)NCCC(F)=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2FNO/c1-12(23)22-11-10-17(21)18(13-2-6-15(19)7-3-13)14-4-8-16(20)9-5-14/h2-9H,10-11H2,1H3,(H,22,23) |
| InChIKey | LSTRWQRITDBTLK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |