C23H23N3O3 — CID 44557004
5-[2-(diethylamino)ethyl]-[1,3]benzodioxolo[5,6-c][1,8]phenanthrolin-6-one (PubChem CID 44557004) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 5-[2-(diethylamino)ethyl]-[1,3]benzodioxolo[5,6-c][1,8]phenanthrolin-6-one.
| Compound Name | 5-[2-(diethylamino)ethyl]-[1,3]benzodioxolo[5,6-c][1,8]phenanthrolin-6-one |
|---|---|
| PubChem CID | 44557004 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 5-[2-(diethylamino)ethyl]-[1,3]benzodioxolo[5,6-c][1,8]phenanthrolin-6-one |
| SMILES | CCN(CC)CCn1c(=O)c2cc3c(cc2c2ccc4cnccc4c21)OCO3 |
| InChI | InChI=1S/C23H23N3O3/c1-3-25(4-2)9-10-26-22-16-7-8-24-13-15(16)5-6-17(22)18-11-20-21(29-14-28-20)12-19(18)23(26)27/h5-8,11-13H,3-4,9-10,14H2,1-2H3 |
| InChIKey | SDHMPFJIYHARSG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|