C21H14O5S5 — CID 44557185
4,6-bis[(E)-2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)ethenyl]thieno[3,4-d][1,3]dithiol-2-one (PubChem CID 44557185) has the molecular formula C21H14O5S5 and a molecular weight of 506.67 g/mol. Its IUPAC name is 4,6-bis[(E)-2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)ethenyl]thieno[3,4-d][1,3]dithiol-2-one.
| Compound Name | 4,6-bis[(E)-2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)ethenyl]thieno[3,4-d][1,3]dithiol-2-one |
|---|---|
| PubChem CID | 44557185 |
| Molecular Formula | C21H14O5S5 |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 505.94 |
| IUPAC Name | 4,6-bis[(E)-2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)ethenyl]thieno[3,4-d][1,3]dithiol-2-one |
| SMILES | O=c1sc2c(/C=C/c3scc4c3OCCO4)sc(/C=C/c3scc4c3OCCO4)c2s1 |
| InChI | InChI=1S/C21H14O5S5/c22-21-30-19-15(3-1-13-17-11(9-27-13)23-5-7-25-17)29-16(20(19)31-21)4-2-14-18-12(10-28-14)24-6-8-26-18/h1-4,9-10H,5-8H2/b3-1+,4-2+ |
| InChIKey | MNCOTAGYLFMXPO-ZPUQHVIOSA-N |
| XLogP | 6.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |