C25H34O6 — CID 44557564
[(5R,5aS,9aS,9bS)-9b-hydroxy-6,6,9a-trimethyl-1-oxo-3,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] (2E,4E,6E)-9-hydroxydeca-2,4,6-trienoate (PubChem CID 44557564) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is [(5R,5aS,9aS,9bS)-9b-hydroxy-6,6,9a-trimethyl-1-oxo-3,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] (2E,4E,6E)-9-hydroxydeca-2,4,6-trienoate.
| Compound Name | [(5R,5aS,9aS,9bS)-9b-hydroxy-6,6,9a-trimethyl-1-oxo-3,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] (2E,4E,6E)-9-hydroxydeca-2,4,6-trienoate |
|---|---|
| PubChem CID | 44557564 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [(5R,5aS,9aS,9bS)-9b-hydroxy-6,6,9a-trimethyl-1-oxo-3,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] (2E,4E,6E)-9-hydroxydeca-2,4,6-trienoate |
| SMILES | CC(O)C/C=C/C=C/C=C/C(=O)O[C@@H]1C=C2COC(=O)[C@]2(O)[C@@]2(C)CCCC(C)(C)[C@H]12 |
| InChI | InChI=1S/C25H34O6/c1-17(26)11-8-6-5-7-9-12-20(27)31-19-15-18-16-30-22(28)25(18,29)24(4)14-10-13-23(2,3)21(19)24/h5-9,12,15,17,19,21,26,29H,10-11,13-14,16H2,1-4H3/b7-5+,8-6+,12-9+/t17?,19-,21+,24+,25+/m1/s1 |
| InChIKey | ZHQUHDHFPDBIHU-OMNMLEGNSA-N |
| XLogP | 3.40 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|