C21H24O5 — CID 44557688
(1S,3R,5R,6S,9S,10R)-9-hydroxy-5,9-dimethyl-3-(2-methylprop-1-enyl)-2-oxatetracyclo[10.4.0.01,5.06,10]hexadeca-11,14-diene-4,13,16-trione (PubChem CID 44557688) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (1S,3R,5R,6S,9S,10R)-9-hydroxy-5,9-dimethyl-3-(2-methylprop-1-enyl)-2-oxatetracyclo[10.4.0.01,5.06,10]hexadeca-11,14-diene-4,13,16-trione.
| Compound Name | (1S,3R,5R,6S,9S,10R)-9-hydroxy-5,9-dimethyl-3-(2-methylprop-1-enyl)-2-oxatetracyclo[10.4.0.01,5.06,10]hexadeca-11,14-diene-4,13,16-trione |
|---|---|
| PubChem CID | 44557688 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (1S,3R,5R,6S,9S,10R)-9-hydroxy-5,9-dimethyl-3-(2-methylprop-1-enyl)-2-oxatetracyclo[10.4.0.01,5.06,10]hexadeca-11,14-diene-4,13,16-trione |
| SMILES | CC(C)=C[C@H]1O[C@@]23C(=O)C=CC(=O)C2=C[C@@H]2[C@H](CC[C@]2(C)O)[C@@]3(C)C1=O |
| InChI | InChI=1S/C21H24O5/c1-11(2)9-16-18(24)20(4)12-7-8-19(3,25)13(12)10-14-15(22)5-6-17(23)21(14,20)26-16/h5-6,9-10,12-13,16,25H,7-8H2,1-4H3/t12-,13+,16+,19-,20-,21+/m0/s1 |
| InChIKey | MCGMYKPCCJOWKR-UAIFVEODSA-N |
| XLogP | 2.09 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|