C9H13F3O2S — CID 44558376
2-[4-(trifluoromethylsulfanyl)cyclohexyl]acetic acid (PubChem CID 44558376) has the molecular formula C9H13F3O2S and a molecular weight of 242.26 g/mol. Its IUPAC name is 2-[4-(trifluoromethylsulfanyl)cyclohexyl]acetic acid.
| Compound Name | 2-[4-(trifluoromethylsulfanyl)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 44558376 |
| Molecular Formula | C9H13F3O2S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-[4-(trifluoromethylsulfanyl)cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1CCC(SC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H13F3O2S/c10-9(11,12)15-7-3-1-6(2-4-7)5-8(13)14/h6-7H,1-5H2,(H,13,14) |
| InChIKey | PXXPRSFJGDWMBX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |