C10H13N3O — CID 44558568
3,4,7,8,9,10-hexahydro-2H-pyrazino[1,2-b]indazol-1-one (PubChem CID 44558568) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 3,4,7,8,9,10-hexahydro-2H-pyrazino[1,2-b]indazol-1-one.
| Compound Name | 3,4,7,8,9,10-hexahydro-2H-pyrazino[1,2-b]indazol-1-one |
|---|---|
| PubChem CID | 44558568 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 3,4,7,8,9,10-hexahydro-2H-pyrazino[1,2-b]indazol-1-one |
| SMILES | O=C1NCCn2nc3c(c21)CCCC3 |
| InChI | InChI=1S/C10H13N3O/c14-10-9-7-3-1-2-4-8(7)12-13(9)6-5-11-10/h1-6H2,(H,11,14) |
| InChIKey | NXJXUHCZSOACBW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |