C7H12ClNO — CID 44558690
5-chloro-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazole (PubChem CID 44558690) has the molecular formula C7H12ClNO and a molecular weight of 161.63 g/mol. Its IUPAC name is 5-chloro-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazole.
| Compound Name | 5-chloro-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 44558690 |
| Molecular Formula | C7H12ClNO |
| Molecular Weight | 161.63 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 5-chloro-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazole |
| SMILES | ClC1CCC2OCNC2C1 |
| InChI | InChI=1S/C7H12ClNO/c8-5-1-2-7-6(3-5)9-4-10-7/h5-7,9H,1-4H2 |
| InChIKey | ZNYOLIGMDZKMRL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.63 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|