C7H9F7N2 — CID 44558756
[2,3,5,6-tetrafluoro-4-(trifluoromethyl)cyclohexyl]hydrazine (PubChem CID 44558756) has the molecular formula C7H9F7N2 and a molecular weight of 254.15 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(trifluoromethyl)cyclohexyl]hydrazine.
| Compound Name | [2,3,5,6-tetrafluoro-4-(trifluoromethyl)cyclohexyl]hydrazine |
|---|---|
| PubChem CID | 44558756 |
| Molecular Formula | C7H9F7N2 |
| Molecular Weight | 254.15 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(trifluoromethyl)cyclohexyl]hydrazine |
| SMILES | NNC1C(F)C(F)C(C(F)(F)F)C(F)C1F |
| InChI | InChI=1S/C7H9F7N2/c8-2-1(7(12,13)14)3(9)5(11)6(16-15)4(2)10/h1-6,16H,15H2 |
| InChIKey | RXMVVOCFFXLTKI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.15 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|