About 3,5-dimethyl-1,2-oxazolidine-4-carbaldehyde
3,5-dimethyl-1,2-oxazolidine-4-carbaldehyde (PubChem CID 44558822) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is 3,5-dimethyl-1,2-oxazolidine-4-carbaldehyde.
Molecular Properties
| Compound Name | 3,5-dimethyl-1,2-oxazolidine-4-carbaldehyde |
| PubChem CID | 44558822 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 3,5-dimethyl-1,2-oxazolidine-4-carbaldehyde |
| SMILES | CC1NOC(C)C1C=O |
| InChI | InChI=1S/C6H11NO2/c1-4-6(3-8)5(2)9-7-4/h3-7H,1-2H3 |
| InChIKey | IDCLCMLPSOWEJW-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-1,2-oxazolidine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,2-oxazolidine-4-carbaldehyde?
The IUPAC name of 3,5-dimethyl-1,2-oxazolidine-4-carbaldehyde (CID 44558822) is 3,5-dimethyl-1,2-oxazolidine-4-carbaldehyde.
What is the SMILES notation for 3,5-dimethyl-1,2-oxazolidine-4-carbaldehyde?
The canonical SMILES for 3,5-dimethyl-1,2-oxazolidine-4-carbaldehyde is CC1NOC(C)C1C=O.
What is the InChIKey of 3,5-dimethyl-1,2-oxazolidine-4-carbaldehyde?
The InChIKey is IDCLCMLPSOWEJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c1-4-6(3-8)5(2)9-7-4/h3-7H,1-2H3.
What are the key properties of 3,5-dimethyl-1,2-oxazolidine-4-carbaldehyde?
3,5-dimethyl-1,2-oxazolidine-4-carbaldehyde has a molecular weight of 129.16 g/mol, XLogP of 0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,2-oxazolidine-4-carbaldehyde is sourced from PubChem (CID 44558822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).