C22H28N2O7 — CID 44558964
[(2R,4aS,5R,7aR,7bS)-5-hydroxy-3,3,5,7b-tetramethyl-1,1a,2,4,4a,6,7,7a-octahydrocyclopropa[e]azulen-2-yl] 3,5-dinitrobenzoate (PubChem CID 44558964) has the molecular formula C22H28N2O7 and a molecular weight of 432.47 g/mol. Its IUPAC name is [(2R,4aS,5R,7aR,7bS)-5-hydroxy-3,3,5,7b-tetramethyl-1,1a,2,4,4a,6,7,7a-octahydrocyclopropa[e]azulen-2-yl] 3,5-dinitrobenzoate.
| Compound Name | [(2R,4aS,5R,7aR,7bS)-5-hydroxy-3,3,5,7b-tetramethyl-1,1a,2,4,4a,6,7,7a-octahydrocyclopropa[e]azulen-2-yl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 44558964 |
| Molecular Formula | C22H28N2O7 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | [(2R,4aS,5R,7aR,7bS)-5-hydroxy-3,3,5,7b-tetramethyl-1,1a,2,4,4a,6,7,7a-octahydrocyclopropa[e]azulen-2-yl] 3,5-dinitrobenzoate |
| SMILES | CC1(C)C[C@H]2[C@@H](CC[C@@]2(C)O)[C@]2(C)CC2[C@H]1OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H28N2O7/c1-20(2)10-16-15(5-6-22(16,4)26)21(3)11-17(21)18(20)31-19(25)12-7-13(23(27)28)9-14(8-12)24(29)30/h7-9,15-18,26H,5-6,10-11H2,1-4H3/t15-,16+,17?,18-,21+,22-/m1/s1 |
| InChIKey | MWHWKBGSBYCHGS-YCKLBQCKSA-N |
| XLogP | 4.26 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|