C30H44O2 — CID 44558968
(3S,4E,15E,18E,28S)-triaconta-4,15,18-trien-1,12,29-triyne-3,28-diol (PubChem CID 44558968) has the molecular formula C30H44O2 and a molecular weight of 436.68 g/mol. Its IUPAC name is (3S,4E,15E,18E,28S)-triaconta-4,15,18-trien-1,12,29-triyne-3,28-diol.
| Compound Name | (3S,4E,15E,18E,28S)-triaconta-4,15,18-trien-1,12,29-triyne-3,28-diol |
|---|---|
| PubChem CID | 44558968 |
| Molecular Formula | C30H44O2 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | (3S,4E,15E,18E,28S)-triaconta-4,15,18-trien-1,12,29-triyne-3,28-diol |
| SMILES | C#C[C@@H](O)/C=C/CCCCCCC#CC/C=C/C/C=C/CCCCCCCC[C@H](O)C#C |
| InChI | InChI=1S/C30H44O2/c1-3-29(31)27-25-23-21-19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-22-24-26-28-30(32)4-2/h1-2,5-6,9,11,26,28-32H,7-8,13-25,27H2/b6-5+,11-9+,28-26+/t29-,30-/m1/s1 |
| InChIKey | OFTQYCLFGNLQKE-LPYHVOQHSA-N |
| XLogP | 6.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|