C26H36O10 — CID 44558971
[(1S,2S,3R,4R,7S,8Z,10R,12S,13R,14S)-2,12-diacetyloxy-3,10-dihydroxy-4,9,13-trimethyl-17-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] acetate (PubChem CID 44558971) has the molecular formula C26H36O10 and a molecular weight of 508.56 g/mol. Its IUPAC name is [(1S,2S,3R,4R,7S,8Z,10R,12S,13R,14S)-2,12-diacetyloxy-3,10-dihydroxy-4,9,13-trimethyl-17-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] acetate.
| Compound Name | [(1S,2S,3R,4R,7S,8Z,10R,12S,13R,14S)-2,12-diacetyloxy-3,10-dihydroxy-4,9,13-trimethyl-17-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] acetate |
|---|---|
| PubChem CID | 44558971 |
| Molecular Formula | C26H36O10 |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | [(1S,2S,3R,4R,7S,8Z,10R,12S,13R,14S)-2,12-diacetyloxy-3,10-dihydroxy-4,9,13-trimethyl-17-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] acetate |
| SMILES | C=C1CC[C@H](OC(C)=O)[C@]2(C)[C@@H](OC(C)=O)C[C@@H](O)/C(C)=C\[C@@H]3OC(=O)[C@H](C)[C@]3(O)[C@@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C26H36O10/c1-12-8-9-19(33-15(4)27)25(7)20(34-16(5)28)11-18(30)13(2)10-21-26(32,14(3)24(31)36-21)23(22(12)25)35-17(6)29/h10,14,18-23,30,32H,1,8-9,11H2,2-7H3/b13-10-/t14-,18+,19-,20-,21-,22+,23-,25+,26+/m0/s1 |
| InChIKey | QISZCQONBPIRLQ-WHHQYBMRSA-N |
| XLogP | 1.76 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|