C28H30O11 — CID 44558978
[(2S,3R,4R,5S)-5-acetyloxy-3-hydroxy-2-[(9R)-4,5,9-trihydroxy-2-methoxy-7-methyl-10-oxoanthracen-9-yl]oxan-4-yl] 3-methylbut-2-enoate (PubChem CID 44558978) has the molecular formula C28H30O11 and a molecular weight of 542.54 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-5-acetyloxy-3-hydroxy-2-[(9R)-4,5,9-trihydroxy-2-methoxy-7-methyl-10-oxoanthracen-9-yl]oxan-4-yl] 3-methylbut-2-enoate.
| Compound Name | [(2S,3R,4R,5S)-5-acetyloxy-3-hydroxy-2-[(9R)-4,5,9-trihydroxy-2-methoxy-7-methyl-10-oxoanthracen-9-yl]oxan-4-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 44558978 |
| Molecular Formula | C28H30O11 |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | [(2S,3R,4R,5S)-5-acetyloxy-3-hydroxy-2-[(9R)-4,5,9-trihydroxy-2-methoxy-7-methyl-10-oxoanthracen-9-yl]oxan-4-yl] 3-methylbut-2-enoate |
| SMILES | COc1cc(O)c2c(c1)[C@@](O)([C@H]1OC[C@H](OC(C)=O)[C@H](OC(=O)C=C(C)C)[C@H]1O)c1cc(C)cc(O)c1C2=O |
| InChI | InChI=1S/C28H30O11/c1-12(2)6-21(32)39-26-20(38-14(4)29)11-37-27(25(26)34)28(35)16-7-13(3)8-18(30)22(16)24(33)23-17(28)9-15(36-5)10-19(23)31/h6-10,20,25-27,30-31,34-35H,11H2,1-5H3/t20-,25+,26-,27-,28+/m0/s1 |
| InChIKey | OLGFJNYTTKMULR-GWEDQHIASA-N |
| XLogP | 1.76 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|