C27H38O4 — CID 44559038
3-[[(1R,2R,4bR,7R,8aR,10aS)-7-hydroxy-1,2,4b,8,8-pentamethyl-3,5,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl]-4-hydroxybenzoic acid (PubChem CID 44559038) has the molecular formula C27H38O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is 3-[[(1R,2R,4bR,7R,8aR,10aS)-7-hydroxy-1,2,4b,8,8-pentamethyl-3,5,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl]-4-hydroxybenzoic acid.
| Compound Name | 3-[[(1R,2R,4bR,7R,8aR,10aS)-7-hydroxy-1,2,4b,8,8-pentamethyl-3,5,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 44559038 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 3-[[(1R,2R,4bR,7R,8aR,10aS)-7-hydroxy-1,2,4b,8,8-pentamethyl-3,5,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl]-4-hydroxybenzoic acid |
| SMILES | C[C@@H]1CC=C2[C@@H](CC[C@H]3C(C)(C)[C@H](O)CC[C@@]23C)[C@]1(C)Cc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C27H38O4/c1-16-6-8-19-20(9-11-22-25(2,3)23(29)12-13-26(19,22)4)27(16,5)15-18-14-17(24(30)31)7-10-21(18)28/h7-8,10,14,16,20,22-23,28-29H,6,9,11-13,15H2,1-5H3,(H,30,31)/t16-,20-,22+,23-,26+,27-/m1/s1 |
| InChIKey | HWGPBUBDNCZOBN-RKSFUGBBSA-N |
| XLogP | 5.82 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|