C21H30O5 — CID 44559136
dimethyl (1S,4E,6Z,10Z,14S)-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-triene-4,10-dicarboxylate (PubChem CID 44559136) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is dimethyl (1S,4E,6Z,10Z,14S)-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-triene-4,10-dicarboxylate.
| Compound Name | dimethyl (1S,4E,6Z,10Z,14S)-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-triene-4,10-dicarboxylate |
|---|---|
| PubChem CID | 44559136 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | dimethyl (1S,4E,6Z,10Z,14S)-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-triene-4,10-dicarboxylate |
| SMILES | COC(=O)/C1=C\CC[C@@H]2O[C@H]2CC/C(C(=O)OC)=C\C=C(/C(C)C)CC1 |
| InChI | InChI=1S/C21H30O5/c1-14(2)15-8-10-16(20(22)24-3)6-5-7-18-19(26-18)13-12-17(11-9-15)21(23)25-4/h6,9,11,14,18-19H,5,7-8,10,12-13H2,1-4H3/b15-9-,16-6-,17-11+/t18-,19-/m0/s1 |
| InChIKey | NJAATXWPYRPTPP-SQGRWJHQSA-N |
| XLogP | 3.89 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|