C31H47NO — CID 44559244
(1R,4aR,7S,8aS,10aS)-N-(1-adamantylmethyl)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxamide (PubChem CID 44559244) has the molecular formula C31H47NO and a molecular weight of 449.72 g/mol. Its IUPAC name is (1R,4aR,7S,8aS,10aS)-N-(1-adamantylmethyl)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxamide.
| Compound Name | (1R,4aR,7S,8aS,10aS)-N-(1-adamantylmethyl)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 44559244 |
| Molecular Formula | C31H47NO |
| Molecular Weight | 449.72 g/mol |
| Exact Mass | 449.37 |
| IUPAC Name | (1R,4aR,7S,8aS,10aS)-N-(1-adamantylmethyl)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxamide |
| SMILES | C=C[C@@]1(C)CC=C2[C@@H](CC[C@@H]3[C@](C)(C(=O)NCC45CC6CC(CC(C6)C4)C5)CCC[C@@]23C)C1 |
| InChI | InChI=1S/C31H47NO/c1-5-28(2)12-9-25-24(19-28)7-8-26-29(25,3)10-6-11-30(26,4)27(33)32-20-31-16-21-13-22(17-31)15-23(14-21)18-31/h5,9,21-24,26H,1,6-8,10-20H2,2-4H3,(H,32,33)/t21?,22?,23?,24-,26-,28-,29-,30+,31?/m0/s1 |
| InChIKey | PQFNGPLIFDHHQQ-PMFBIFCRSA-N |
| XLogP | 7.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.72 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|