C25H34O6 — CID 44559444
[(2S,3R,3aR,4S,5R,7aR)-3-acetyl-2-[(Z)-2-methylbut-2-enoyl]oxy-7-methylidene-4-propan-2-yl-1,2,3,3a,4,5,6,7a-octahydroinden-5-yl] 4-methyl-2H-oxete-3-carboxylate (PubChem CID 44559444) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is [(2S,3R,3aR,4S,5R,7aR)-3-acetyl-2-[(Z)-2-methylbut-2-enoyl]oxy-7-methylidene-4-propan-2-yl-1,2,3,3a,4,5,6,7a-octahydroinden-5-yl] 4-methyl-2H-oxete-3-carboxylate.
| Compound Name | [(2S,3R,3aR,4S,5R,7aR)-3-acetyl-2-[(Z)-2-methylbut-2-enoyl]oxy-7-methylidene-4-propan-2-yl-1,2,3,3a,4,5,6,7a-octahydroinden-5-yl] 4-methyl-2H-oxete-3-carboxylate |
|---|---|
| PubChem CID | 44559444 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [(2S,3R,3aR,4S,5R,7aR)-3-acetyl-2-[(Z)-2-methylbut-2-enoyl]oxy-7-methylidene-4-propan-2-yl-1,2,3,3a,4,5,6,7a-octahydroinden-5-yl] 4-methyl-2H-oxete-3-carboxylate |
| SMILES | C=C1C[C@@H](OC(=O)C2=C(C)OC2)[C@@H](C(C)C)[C@@H]2[C@@H](C(C)=O)[C@@H](OC(=O)/C(C)=C\C)C[C@@H]12 |
| InChI | InChI=1S/C25H34O6/c1-8-13(4)24(27)30-20-10-17-14(5)9-19(31-25(28)18-11-29-16(18)7)21(12(2)3)23(17)22(20)15(6)26/h8,12,17,19-23H,5,9-11H2,1-4,6-7H3/b13-8-/t17-,19+,20-,21+,22-,23+/m0/s1 |
| InChIKey | WYABLCZFBNCHMK-XPCSIBJKSA-N |
| XLogP | 4.15 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|