C21H31N — CID 44559505
(1S,3aS,4S,6aR,7S,9bS)-1,4,7-trimethyl-9-(2-methylprop-1-enyl)-1,2,3,4,5,6,6a,7,8,9b-decahydrophenalene-3a-carbonitrile (PubChem CID 44559505) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is (1S,3aS,4S,6aR,7S,9bS)-1,4,7-trimethyl-9-(2-methylprop-1-enyl)-1,2,3,4,5,6,6a,7,8,9b-decahydrophenalene-3a-carbonitrile.
| Compound Name | (1S,3aS,4S,6aR,7S,9bS)-1,4,7-trimethyl-9-(2-methylprop-1-enyl)-1,2,3,4,5,6,6a,7,8,9b-decahydrophenalene-3a-carbonitrile |
|---|---|
| PubChem CID | 44559505 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (1S,3aS,4S,6aR,7S,9bS)-1,4,7-trimethyl-9-(2-methylprop-1-enyl)-1,2,3,4,5,6,6a,7,8,9b-decahydrophenalene-3a-carbonitrile |
| SMILES | CC(C)=CC1=C2[C@@H]3[C@H](CC[C@H](C)[C@@]3(C#N)CC[C@@H]2C)[C@@H](C)C1 |
| InChI | InChI=1S/C21H31N/c1-13(2)10-17-11-15(4)18-7-6-16(5)21(12-22)9-8-14(3)19(17)20(18)21/h10,14-16,18,20H,6-9,11H2,1-5H3/t14-,15-,16-,18+,20-,21-/m0/s1 |
| InChIKey | RZOWSZJNZPHIJY-XDBTUQKASA-N |
| XLogP | 5.89 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |