C18H33NO6 — CID 44559511
(2R,3R,4R,5R)-2-[4-[(2R,6S)-1,7-dioxaspiro[5.5]undecan-2-yl]-1-hydroxybutyl]-5-(hydroxymethyl)pyrrolidine-3,4-diol (PubChem CID 44559511) has the molecular formula C18H33NO6 and a molecular weight of 359.46 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-[4-[(2R,6S)-1,7-dioxaspiro[5.5]undecan-2-yl]-1-hydroxybutyl]-5-(hydroxymethyl)pyrrolidine-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-[4-[(2R,6S)-1,7-dioxaspiro[5.5]undecan-2-yl]-1-hydroxybutyl]-5-(hydroxymethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 44559511 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | (2R,3R,4R,5R)-2-[4-[(2R,6S)-1,7-dioxaspiro[5.5]undecan-2-yl]-1-hydroxybutyl]-5-(hydroxymethyl)pyrrolidine-3,4-diol |
| SMILES | OC[C@H]1N[C@H](C(O)CCC[C@@H]2CCC[C@]3(CCCCO3)O2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H33NO6/c20-11-13-16(22)17(23)15(19-13)14(21)7-3-5-12-6-4-9-18(25-12)8-1-2-10-24-18/h12-17,19-23H,1-11H2/t12-,13-,14?,15-,16-,17-,18+/m1/s1 |
| InChIKey | LIWCKHSHUMELES-IFZFKGJESA-N |
| XLogP | 0.04 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |