C21H26O4 — CID 44559587
[(8E,10E,12E)-14-acetyloxyheptadeca-8,10,12-trien-4,6-diynyl] acetate (PubChem CID 44559587) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is [(8E,10E,12E)-14-acetyloxyheptadeca-8,10,12-trien-4,6-diynyl] acetate.
| Compound Name | [(8E,10E,12E)-14-acetyloxyheptadeca-8,10,12-trien-4,6-diynyl] acetate |
|---|---|
| PubChem CID | 44559587 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | [(8E,10E,12E)-14-acetyloxyheptadeca-8,10,12-trien-4,6-diynyl] acetate |
| SMILES | CCCC(/C=C/C=C/C=C/C#CC#CCCCOC(C)=O)OC(C)=O |
| InChI | InChI=1S/C21H26O4/c1-4-16-21(25-20(3)23)17-14-12-10-8-6-5-7-9-11-13-15-18-24-19(2)22/h6,8,10,12,14,17,21H,4,13,15-16,18H2,1-3H3/b8-6+,12-10+,17-14+ |
| InChIKey | WXSAEKWPSCLCGV-SRUHFADLSA-N |
| XLogP | 3.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|