C25H38O6 — CID 44559590
(8E,10E,12E)-1,14-bis(2-methoxyethoxymethoxy)heptadeca-8,10,12-trien-4,6-diyne (PubChem CID 44559590) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is (8E,10E,12E)-1,14-bis(2-methoxyethoxymethoxy)heptadeca-8,10,12-trien-4,6-diyne.
| Compound Name | (8E,10E,12E)-1,14-bis(2-methoxyethoxymethoxy)heptadeca-8,10,12-trien-4,6-diyne |
|---|---|
| PubChem CID | 44559590 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | (8E,10E,12E)-1,14-bis(2-methoxyethoxymethoxy)heptadeca-8,10,12-trien-4,6-diyne |
| SMILES | CCCC(/C=C/C=C/C=C/C#CC#CCCCOCOCCOC)OCOCCOC |
| InChI | InChI=1S/C25H38O6/c1-4-16-25(31-24-30-22-20-27-3)17-14-12-10-8-6-5-7-9-11-13-15-18-28-23-29-21-19-26-2/h6,8,10,12,14,17,25H,4,13,15-16,18-24H2,1-3H3/b8-6+,12-10+,17-14+ |
| InChIKey | ZJFBOGBITGUVQR-SRUHFADLSA-N |
| XLogP | 3.88 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|