C36H40O15 — CID 44559611
[2-acetyl-3-acetyloxy-4-[[3-acetyl-2,4,6-triacetyloxy-5-(2-acetyloxy-3-methylbut-3-enyl)phenyl]methyl]-5-methoxy-6-methylphenyl] acetate (PubChem CID 44559611) has the molecular formula C36H40O15 and a molecular weight of 712.70 g/mol. Its IUPAC name is [2-acetyl-3-acetyloxy-4-[[3-acetyl-2,4,6-triacetyloxy-5-(2-acetyloxy-3-methylbut-3-enyl)phenyl]methyl]-5-methoxy-6-methylphenyl] acetate.
| Compound Name | [2-acetyl-3-acetyloxy-4-[[3-acetyl-2,4,6-triacetyloxy-5-(2-acetyloxy-3-methylbut-3-enyl)phenyl]methyl]-5-methoxy-6-methylphenyl] acetate |
|---|---|
| PubChem CID | 44559611 |
| Molecular Formula | C36H40O15 |
| Molecular Weight | 712.70 g/mol |
| Exact Mass | 712.24 |
| IUPAC Name | [2-acetyl-3-acetyloxy-4-[[3-acetyl-2,4,6-triacetyloxy-5-(2-acetyloxy-3-methylbut-3-enyl)phenyl]methyl]-5-methoxy-6-methylphenyl] acetate |
| SMILES | C=C(C)C(Cc1c(OC(C)=O)c(Cc2c(OC)c(C)c(OC(C)=O)c(C(C)=O)c2OC(C)=O)c(OC(C)=O)c(C(C)=O)c1OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C36H40O15/c1-15(2)28(46-19(6)39)14-27-33(48-21(8)41)26(35(50-23(10)43)30(18(5)38)36(27)51-24(11)44)13-25-31(45-12)16(3)32(47-20(7)40)29(17(4)37)34(25)49-22(9)42/h28H,1,13-14H2,2-12H3 |
| InChIKey | KCWUIIFHMXCXMG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 201.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.70 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|