C38H44O15 — CID 44559613
[2-acetyl-3-acetyloxy-5-methoxy-6-methyl-4-[[2,4,6-triacetyloxy-3-(2-acetyloxy-3-methylbut-3-enyl)-5-butanoylphenyl]methyl]phenyl] acetate (PubChem CID 44559613) has the molecular formula C38H44O15 and a molecular weight of 740.75 g/mol. Its IUPAC name is [2-acetyl-3-acetyloxy-5-methoxy-6-methyl-4-[[2,4,6-triacetyloxy-3-(2-acetyloxy-3-methylbut-3-enyl)-5-butanoylphenyl]methyl]phenyl] acetate.
| Compound Name | [2-acetyl-3-acetyloxy-5-methoxy-6-methyl-4-[[2,4,6-triacetyloxy-3-(2-acetyloxy-3-methylbut-3-enyl)-5-butanoylphenyl]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 44559613 |
| Molecular Formula | C38H44O15 |
| Molecular Weight | 740.75 g/mol |
| Exact Mass | 740.27 |
| IUPAC Name | [2-acetyl-3-acetyloxy-5-methoxy-6-methyl-4-[[2,4,6-triacetyloxy-3-(2-acetyloxy-3-methylbut-3-enyl)-5-butanoylphenyl]methyl]phenyl] acetate |
| SMILES | C=C(C)C(Cc1c(OC(C)=O)c(Cc2c(OC)c(C)c(OC(C)=O)c(C(C)=O)c2OC(C)=O)c(OC(C)=O)c(C(=O)CCC)c1OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C38H44O15/c1-13-14-29(46)32-37(52-24(10)44)27(35(50-22(8)42)28(38(32)53-25(11)45)16-30(17(2)3)48-20(6)40)15-26-33(47-12)18(4)34(49-21(7)41)31(19(5)39)36(26)51-23(9)43/h30H,2,13-16H2,1,3-12H3 |
| InChIKey | NWQFDEKCAYHPEZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 201.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.75 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|