C19H26O6 — CID 44559614
[(3aS,4S,5R,10E,11aR)-3a,4-dihydroxy-6,10-dimethyl-3-methylidene-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-5-yl] 2-methylpropanoate (PubChem CID 44559614) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(3aS,4S,5R,10E,11aR)-3a,4-dihydroxy-6,10-dimethyl-3-methylidene-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-5-yl] 2-methylpropanoate.
| Compound Name | [(3aS,4S,5R,10E,11aR)-3a,4-dihydroxy-6,10-dimethyl-3-methylidene-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-5-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 44559614 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [(3aS,4S,5R,10E,11aR)-3a,4-dihydroxy-6,10-dimethyl-3-methylidene-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-5-yl] 2-methylpropanoate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CCC=C(C)[C@@H](OC(=O)C(C)C)[C@H](O)[C@@]12O |
| InChI | InChI=1S/C19H26O6/c1-10(2)17(21)25-15-12(4)8-6-7-11(3)9-14-19(23,16(15)20)13(5)18(22)24-14/h8-10,14-16,20,23H,5-7H2,1-4H3/b11-9+,12-8?/t14-,15-,16+,19-/m1/s1 |
| InChIKey | FZIMMWCUIWUUCH-VDDFIEPUSA-N |
| XLogP | 1.81 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|