C15H26O2 — CID 44559650
(2S)-2-[(1S,2S,5S,6S,8S)-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undecan-8-yl]propan-1-ol (PubChem CID 44559650) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (2S)-2-[(1S,2S,5S,6S,8S)-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undecan-8-yl]propan-1-ol.
| Compound Name | (2S)-2-[(1S,2S,5S,6S,8S)-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undecan-8-yl]propan-1-ol |
|---|---|
| PubChem CID | 44559650 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (2S)-2-[(1S,2S,5S,6S,8S)-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undecan-8-yl]propan-1-ol |
| SMILES | C[C@H]1CC[C@H]2[C@H]1C[C@]1([C@@H](C)CO)CC[C@]2(C)O1 |
| InChI | InChI=1S/C15H26O2/c1-10-4-5-13-12(10)8-15(11(2)9-16)7-6-14(13,3)17-15/h10-13,16H,4-9H2,1-3H3/t10-,11-,12-,13-,14-,15-/m0/s1 |
| InChIKey | QDCOGXJHEDTDOW-LZXPERKUSA-N |
| XLogP | 2.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |