C47H70O11 — CID 44559664
(26Z,39E,43E)-4,6,17,31,34,37,42,45-octahydroxy-16-oxoheptatetraconta-26,39,43-trien-2,32,35,46-tetraynoic acid (PubChem CID 44559664) has the molecular formula C47H70O11 and a molecular weight of 811.07 g/mol. Its IUPAC name is (26Z,39E,43E)-4,6,17,31,34,37,42,45-octahydroxy-16-oxoheptatetraconta-26,39,43-trien-2,32,35,46-tetraynoic acid.
| Compound Name | (26Z,39E,43E)-4,6,17,31,34,37,42,45-octahydroxy-16-oxoheptatetraconta-26,39,43-trien-2,32,35,46-tetraynoic acid |
|---|---|
| PubChem CID | 44559664 |
| Molecular Formula | C47H70O11 |
| Molecular Weight | 811.07 g/mol |
| Exact Mass | 810.49 |
| IUPAC Name | (26Z,39E,43E)-4,6,17,31,34,37,42,45-octahydroxy-16-oxoheptatetraconta-26,39,43-trien-2,32,35,46-tetraynoic acid |
| SMILES | C#CC(O)/C=C/C(O)C/C=C/CC(O)C#CC(O)C#CC(O)CCC/C=C\CCCCCCCCC(O)C(=O)CCCCCCCCCC(O)CC(O)C#CC(=O)O |
| InChI | InChI=1S/C47H70O11/c1-2-38(48)29-30-40(50)24-21-22-25-41(51)32-34-42(52)33-31-39(49)23-17-13-9-6-4-3-5-7-11-15-19-27-45(55)46(56)28-20-16-12-8-10-14-18-26-43(53)37-44(54)35-36-47(57)58/h1,6,9,21-22,29-30,38-45,48-55H,3-5,7-8,10-20,23-28,37H2,(H,57,58)/b9-6-,22-21+,30-29+ |
| InChIKey | KRUXMXQCPNUFNI-JJOPJJRMSA-N |
| XLogP | 4.81 |
| TPSA | 216.21 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.07 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|