C37H54O5 — CID 44559683
[(1R,5S,6R,7S)-6-methyl-1,3,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)-5-(2-methylpropanoyl)-4,9-dioxo-2-bicyclo[3.3.1]non-2-enyl] acetate (PubChem CID 44559683) has the molecular formula C37H54O5 and a molecular weight of 578.83 g/mol. Its IUPAC name is [(1R,5S,6R,7S)-6-methyl-1,3,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)-5-(2-methylpropanoyl)-4,9-dioxo-2-bicyclo[3.3.1]non-2-enyl] acetate.
| Compound Name | [(1R,5S,6R,7S)-6-methyl-1,3,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)-5-(2-methylpropanoyl)-4,9-dioxo-2-bicyclo[3.3.1]non-2-enyl] acetate |
|---|---|
| PubChem CID | 44559683 |
| Molecular Formula | C37H54O5 |
| Molecular Weight | 578.83 g/mol |
| Exact Mass | 578.40 |
| IUPAC Name | [(1R,5S,6R,7S)-6-methyl-1,3,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)-5-(2-methylpropanoyl)-4,9-dioxo-2-bicyclo[3.3.1]non-2-enyl] acetate |
| SMILES | CC(=O)OC1=C(CC=C(C)C)C(=O)[C@]2(C(=O)C(C)C)C(=O)[C@]1(CC=C(C)C)C[C@H](CC=C(C)C)[C@@]2(C)CCC=C(C)C |
| InChI | InChI=1S/C37H54O5/c1-23(2)14-13-20-35(12)29(17-15-24(3)4)22-36(21-19-26(7)8)33(42-28(11)38)30(18-16-25(5)6)32(40)37(35,34(36)41)31(39)27(9)10/h14-16,19,27,29H,13,17-18,20-22H2,1-12H3/t29-,35+,36+,37+/m0/s1 |
| InChIKey | JZPNZEVHKFXJKG-NVGSILRDSA-N |
| XLogP | 8.99 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.83 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|