C36H54O4 — CID 44559694
(1R,3S,5S,6R,7S)-3,6-dimethyl-1,3,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)-5-(2-methylpropanoyl)bicyclo[3.3.1]nonane-2,4,9-trione (PubChem CID 44559694) has the molecular formula C36H54O4 and a molecular weight of 550.82 g/mol. Its IUPAC name is (1R,3S,5S,6R,7S)-3,6-dimethyl-1,3,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)-5-(2-methylpropanoyl)bicyclo[3.3.1]nonane-2,4,9-trione.
| Compound Name | (1R,3S,5S,6R,7S)-3,6-dimethyl-1,3,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)-5-(2-methylpropanoyl)bicyclo[3.3.1]nonane-2,4,9-trione |
|---|---|
| PubChem CID | 44559694 |
| Molecular Formula | C36H54O4 |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.40 |
| IUPAC Name | (1R,3S,5S,6R,7S)-3,6-dimethyl-1,3,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)-5-(2-methylpropanoyl)bicyclo[3.3.1]nonane-2,4,9-trione |
| SMILES | CC(C)=CCC[C@]1(C)[C@@H](CC=C(C)C)C[C@]2(CC=C(C)C)C(=O)[C@](C)(CC=C(C)C)C(=O)[C@]1(C(=O)C(C)C)C2=O |
| InChI | InChI=1S/C36H54O4/c1-23(2)14-13-19-34(12)28(16-15-24(3)4)22-35(21-18-26(7)8)30(38)33(11,20-17-25(5)6)31(39)36(34,32(35)40)29(37)27(9)10/h14-15,17-18,27-28H,13,16,19-22H2,1-12H3/t28-,33-,34+,35+,36+/m0/s1 |
| InChIKey | HMBOUVNSIVRGPO-OSNKRYAHSA-N |
| XLogP | 8.75 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|