C20H30O4 — CID 44559807
(1S,2E,5S,6E,9R,10Z,14R,15S)-5,9-dihydroxy-15-(hydroxymethyl)-3,7,11,15-tetramethylbicyclo[12.1.0]pentadeca-2,6,10-trien-4-one (PubChem CID 44559807) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,2E,5S,6E,9R,10Z,14R,15S)-5,9-dihydroxy-15-(hydroxymethyl)-3,7,11,15-tetramethylbicyclo[12.1.0]pentadeca-2,6,10-trien-4-one.
| Compound Name | (1S,2E,5S,6E,9R,10Z,14R,15S)-5,9-dihydroxy-15-(hydroxymethyl)-3,7,11,15-tetramethylbicyclo[12.1.0]pentadeca-2,6,10-trien-4-one |
|---|---|
| PubChem CID | 44559807 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1S,2E,5S,6E,9R,10Z,14R,15S)-5,9-dihydroxy-15-(hydroxymethyl)-3,7,11,15-tetramethylbicyclo[12.1.0]pentadeca-2,6,10-trien-4-one |
| SMILES | C/C1=C/[C@H](O)C/C(C)=C/[C@H](O)C(=O)/C(C)=C/[C@H]2[C@@H](CC1)[C@]2(C)CO |
| InChI | InChI=1S/C20H30O4/c1-12-5-6-16-17(20(16,4)11-21)10-14(3)19(24)18(23)9-13(2)8-15(22)7-12/h7,9-10,15-18,21-23H,5-6,8,11H2,1-4H3/b12-7-,13-9+,14-10+/t15-,16+,17-,18-,20-/m0/s1 |
| InChIKey | FEOSJHQSWIDLGT-RZEPPYQOSA-N |
| XLogP | 2.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|