C20H30O3 — CID 44559944
2-[(2E,6Z,9Z,12Z,15Z)-octadeca-2,6,9,12,15-pentaenoxy]acetic acid (PubChem CID 44559944) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-[(2E,6Z,9Z,12Z,15Z)-octadeca-2,6,9,12,15-pentaenoxy]acetic acid.
| Compound Name | 2-[(2E,6Z,9Z,12Z,15Z)-octadeca-2,6,9,12,15-pentaenoxy]acetic acid |
|---|---|
| PubChem CID | 44559944 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2-[(2E,6Z,9Z,12Z,15Z)-octadeca-2,6,9,12,15-pentaenoxy]acetic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CC/C=C/COCC(=O)O |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-19-20(21)22/h3-4,6-7,9-10,12-13,16-17H,2,5,8,11,14-15,18-19H2,1H3,(H,21,22)/b4-3-,7-6-,10-9-,13-12-,17-16+ |
| InChIKey | HYRVVXJWCJCBMU-IIFHDYRKSA-N |
| XLogP | 5.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|