C26H34N2O2 — CID 44559974
(1R,4aR,9aR)-8-amino-6-anilino-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,9a,10-hexahydroanthracene-1-carboxylic acid (PubChem CID 44559974) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is (1R,4aR,9aR)-8-amino-6-anilino-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,9a,10-hexahydroanthracene-1-carboxylic acid.
| Compound Name | (1R,4aR,9aR)-8-amino-6-anilino-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,9a,10-hexahydroanthracene-1-carboxylic acid |
|---|---|
| PubChem CID | 44559974 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | (1R,4aR,9aR)-8-amino-6-anilino-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,9a,10-hexahydroanthracene-1-carboxylic acid |
| SMILES | CC(C)c1c(Nc2ccccc2)cc2c(c1N)C[C@@H]1[C@](C)(CCC[C@@]1(C)C(=O)O)C2 |
| InChI | InChI=1S/C26H34N2O2/c1-16(2)22-20(28-18-9-6-5-7-10-18)13-17-15-25(3)11-8-12-26(4,24(29)30)21(25)14-19(17)23(22)27/h5-7,9-10,13,16,21,28H,8,11-12,14-15,27H2,1-4H3,(H,29,30)/t21-,25-,26-/m1/s1 |
| InChIKey | GAQHRNDCFWFCHN-LPPUWEFUSA-N |
| XLogP | 6.13 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|