C32H38N2O2 — CID 44559981
(1R,4aR,9aR)-6,8-dianilino-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,9a,10-hexahydroanthracene-1-carboxylic acid (PubChem CID 44559981) has the molecular formula C32H38N2O2 and a molecular weight of 482.67 g/mol. Its IUPAC name is (1R,4aR,9aR)-6,8-dianilino-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,9a,10-hexahydroanthracene-1-carboxylic acid.
| Compound Name | (1R,4aR,9aR)-6,8-dianilino-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,9a,10-hexahydroanthracene-1-carboxylic acid |
|---|---|
| PubChem CID | 44559981 |
| Molecular Formula | C32H38N2O2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | (1R,4aR,9aR)-6,8-dianilino-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,9a,10-hexahydroanthracene-1-carboxylic acid |
| SMILES | CC(C)c1c(Nc2ccccc2)cc2c(c1Nc1ccccc1)C[C@@H]1[C@](C)(CCC[C@@]1(C)C(=O)O)C2 |
| InChI | InChI=1S/C32H38N2O2/c1-21(2)28-26(33-23-12-7-5-8-13-23)18-22-20-31(3)16-11-17-32(4,30(35)36)27(31)19-25(22)29(28)34-24-14-9-6-10-15-24/h5-10,12-15,18,21,27,33-34H,11,16-17,19-20H2,1-4H3,(H,35,36)/t27-,31-,32-/m1/s1 |
| InChIKey | ZXMPYKPQYSJGMS-MBYALERHSA-N |
| XLogP | 8.29 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |