C26H32N2O4 — CID 44559988
(1R,4aR,9aR)-6-anilino-1,4a-dimethyl-8-nitro-7-propan-2-yl-2,3,4,9,9a,10-hexahydroanthracene-1-carboxylic acid (PubChem CID 44559988) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is (1R,4aR,9aR)-6-anilino-1,4a-dimethyl-8-nitro-7-propan-2-yl-2,3,4,9,9a,10-hexahydroanthracene-1-carboxylic acid.
| Compound Name | (1R,4aR,9aR)-6-anilino-1,4a-dimethyl-8-nitro-7-propan-2-yl-2,3,4,9,9a,10-hexahydroanthracene-1-carboxylic acid |
|---|---|
| PubChem CID | 44559988 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | (1R,4aR,9aR)-6-anilino-1,4a-dimethyl-8-nitro-7-propan-2-yl-2,3,4,9,9a,10-hexahydroanthracene-1-carboxylic acid |
| SMILES | CC(C)c1c(Nc2ccccc2)cc2c(c1[N+](=O)[O-])C[C@@H]1[C@](C)(CCC[C@@]1(C)C(=O)O)C2 |
| InChI | InChI=1S/C26H32N2O4/c1-16(2)22-20(27-18-9-6-5-7-10-18)13-17-15-25(3)11-8-12-26(4,24(29)30)21(25)14-19(17)23(22)28(31)32/h5-7,9-10,13,16,21,27H,8,11-12,14-15H2,1-4H3,(H,29,30)/t21-,25-,26-/m1/s1 |
| InChIKey | LVTHWMRANIRNGD-LPPUWEFUSA-N |
| XLogP | 6.46 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|