C26H40O3 — CID 44560008
(1S,5S,7R)-4-hydroxy-5,8,8-trimethyl-1,7-bis(3-methylbut-2-enyl)-3-(2-methylpropanoyl)bicyclo[3.3.1]non-3-en-2-one (PubChem CID 44560008) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is (1S,5S,7R)-4-hydroxy-5,8,8-trimethyl-1,7-bis(3-methylbut-2-enyl)-3-(2-methylpropanoyl)bicyclo[3.3.1]non-3-en-2-one.
| Compound Name | (1S,5S,7R)-4-hydroxy-5,8,8-trimethyl-1,7-bis(3-methylbut-2-enyl)-3-(2-methylpropanoyl)bicyclo[3.3.1]non-3-en-2-one |
|---|---|
| PubChem CID | 44560008 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | (1S,5S,7R)-4-hydroxy-5,8,8-trimethyl-1,7-bis(3-methylbut-2-enyl)-3-(2-methylpropanoyl)bicyclo[3.3.1]non-3-en-2-one |
| SMILES | CC(C)=CC[C@@H]1C[C@@]2(C)C[C@](CC=C(C)C)(C(=O)C(C(=O)C(C)C)=C2O)C1(C)C |
| InChI | InChI=1S/C26H40O3/c1-16(2)10-11-19-14-25(9)15-26(24(19,7)8,13-12-17(3)4)23(29)20(22(25)28)21(27)18(5)6/h10,12,18-19,28H,11,13-15H2,1-9H3/t19-,25+,26-/m1/s1 |
| InChIKey | HIPRQPWMNBMKNC-JSRBVGTNSA-N |
| XLogP | 6.75 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|