C16H31NO6 — CID 44560308
nonyl (2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 44560308) has the molecular formula C16H31NO6 and a molecular weight of 333.43 g/mol. Its IUPAC name is nonyl (2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidine-1-carboxylate.
| Compound Name | nonyl (2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 44560308 |
| Molecular Formula | C16H31NO6 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | nonyl (2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | CCCCCCCCCOC(=O)N1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C16H31NO6/c1-2-3-4-5-6-7-8-9-23-16(22)17-10-13(19)15(21)14(20)12(17)11-18/h12-15,18-21H,2-11H2,1H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | ZDKHIJYWALSAFU-LXTVHRRPSA-N |
| XLogP | 0.63 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|