About 3-[(2,6-dichloro-3-fluorophenyl)methoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine
3-[(2,6-dichloro-3-fluorophenyl)methoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine (PubChem CID 44560358) has the molecular formula C20H20Cl2FN5O
and a molecular weight of 436.32 g/mol. Its IUPAC name is 3-[(2,6-dichloro-3-fluorophenyl)methoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-[(2,6-dichloro-3-fluorophenyl)methoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine |
| PubChem CID | 44560358 |
| Molecular Formula | C20H20Cl2FN5O |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 3-[(2,6-dichloro-3-fluorophenyl)methoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine |
| SMILES | Nc1ncc(-c2cnn(C3CCNCC3)c2)cc1OCc1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C20H20Cl2FN5O/c21-16-1-2-17(23)19(22)15(16)11-29-18-7-12(8-26-20(18)24)13-9-27-28(10-13)14-3-5-25-6-4-14/h1-2,7-10,14,25H,3-6,11H2,(H2,24,26) |
| InChIKey | SZSQAKDNRSCZOY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,6-dichloro-3-fluorophenyl)methoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dichloro-3-fluorophenyl)methoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine?
The IUPAC name of 3-[(2,6-dichloro-3-fluorophenyl)methoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine (CID 44560358) is 3-[(2,6-dichloro-3-fluorophenyl)methoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine.
What is the SMILES notation for 3-[(2,6-dichloro-3-fluorophenyl)methoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine?
The canonical SMILES for 3-[(2,6-dichloro-3-fluorophenyl)methoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine is Nc1ncc(-c2cnn(C3CCNCC3)c2)cc1OCc1c(Cl)ccc(F)c1Cl.
What is the InChIKey of 3-[(2,6-dichloro-3-fluorophenyl)methoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine?
The InChIKey is SZSQAKDNRSCZOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20Cl2FN5O/c21-16-1-2-17(23)19(22)15(16)11-29-18-7-12(8-26-20(18)24)13-9-27-28(10-13)14-3-5-25-6-4-14/h1-2,7-10,14,25H,3-6,11H2,(H2,24,26).
What are the key properties of 3-[(2,6-dichloro-3-fluorophenyl)methoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine?
3-[(2,6-dichloro-3-fluorophenyl)methoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine has a molecular weight of 436.32 g/mol, XLogP of 4.48, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dichloro-3-fluorophenyl)methoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine is sourced from PubChem (CID 44560358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).