About 3-hydroxy-2,2-dimethyl-3-[2-[(E)-2-phenylethenyl]phenyl]-N-prop-2-enylpropanamide
3-hydroxy-2,2-dimethyl-3-[2-[(E)-2-phenylethenyl]phenyl]-N-prop-2-enylpropanamide (PubChem CID 44560413) has the molecular formula C22H25NO2
and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethyl-3-[2-[(E)-2-phenylethenyl]phenyl]-N-prop-2-enylpropanamide.
Molecular Properties
| Compound Name | 3-hydroxy-2,2-dimethyl-3-[2-[(E)-2-phenylethenyl]phenyl]-N-prop-2-enylpropanamide |
| PubChem CID | 44560413 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 3-hydroxy-2,2-dimethyl-3-[2-[(E)-2-phenylethenyl]phenyl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)(C)C(O)c1ccccc1/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c1-4-16-23-21(25)22(2,3)20(24)19-13-9-8-12-18(19)15-14-17-10-6-5-7-11-17/h4-15,20,24H,1,16H2,2-3H3,(H,23,25)/b15-14+ |
| InChIKey | GZDJZZVBDHTVHK-CCEZHUSRSA-N |
| XLogP | 4.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2,2-dimethyl-3-[2-[(E)-2-phenylethenyl]phenyl]-N-prop-2-enylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2,2-dimethyl-3-[2-[(E)-2-phenylethenyl]phenyl]-N-prop-2-enylpropanamide?
The IUPAC name of 3-hydroxy-2,2-dimethyl-3-[2-[(E)-2-phenylethenyl]phenyl]-N-prop-2-enylpropanamide (CID 44560413) is 3-hydroxy-2,2-dimethyl-3-[2-[(E)-2-phenylethenyl]phenyl]-N-prop-2-enylpropanamide.
What is the SMILES notation for 3-hydroxy-2,2-dimethyl-3-[2-[(E)-2-phenylethenyl]phenyl]-N-prop-2-enylpropanamide?
The canonical SMILES for 3-hydroxy-2,2-dimethyl-3-[2-[(E)-2-phenylethenyl]phenyl]-N-prop-2-enylpropanamide is C=CCNC(=O)C(C)(C)C(O)c1ccccc1/C=C/c1ccccc1.
What is the InChIKey of 3-hydroxy-2,2-dimethyl-3-[2-[(E)-2-phenylethenyl]phenyl]-N-prop-2-enylpropanamide?
The InChIKey is GZDJZZVBDHTVHK-CCEZHUSRSA-N. The full InChI is InChI=1S/C22H25NO2/c1-4-16-23-21(25)22(2,3)20(24)19-13-9-8-12-18(19)15-14-17-10-6-5-7-11-17/h4-15,20,24H,1,16H2,2-3H3,(H,23,25)/b15-14+.
What are the key properties of 3-hydroxy-2,2-dimethyl-3-[2-[(E)-2-phenylethenyl]phenyl]-N-prop-2-enylpropanamide?
3-hydroxy-2,2-dimethyl-3-[2-[(E)-2-phenylethenyl]phenyl]-N-prop-2-enylpropanamide has a molecular weight of 335.45 g/mol, XLogP of 4.22, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,2-dimethyl-3-[2-[(E)-2-phenylethenyl]phenyl]-N-prop-2-enylpropanamide is sourced from PubChem (CID 44560413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).