C16H21NO2 — CID 44560415
(4Z,6E)-3-hydroxy-2,2,4-trimethyl-7-phenylhepta-4,6-dienamide (PubChem CID 44560415) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (4Z,6E)-3-hydroxy-2,2,4-trimethyl-7-phenylhepta-4,6-dienamide.
| Compound Name | (4Z,6E)-3-hydroxy-2,2,4-trimethyl-7-phenylhepta-4,6-dienamide |
|---|---|
| PubChem CID | 44560415 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (4Z,6E)-3-hydroxy-2,2,4-trimethyl-7-phenylhepta-4,6-dienamide |
| SMILES | C/C(=C/C=C/c1ccccc1)C(O)C(C)(C)C(N)=O |
| InChI | InChI=1S/C16H21NO2/c1-12(14(18)16(2,3)15(17)19)8-7-11-13-9-5-4-6-10-13/h4-11,14,18H,1-3H3,(H2,17,19)/b11-7+,12-8- |
| InChIKey | YSFDTLGVPLFRNN-RLCSYUECSA-N |
| XLogP | 2.52 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|