About 3-hydroxy-2,2-dimethyl-3-phenyl-N-propylpropanamide
3-hydroxy-2,2-dimethyl-3-phenyl-N-propylpropanamide (PubChem CID 44560511) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethyl-3-phenyl-N-propylpropanamide.
Molecular Properties
| Compound Name | 3-hydroxy-2,2-dimethyl-3-phenyl-N-propylpropanamide |
| PubChem CID | 44560511 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 3-hydroxy-2,2-dimethyl-3-phenyl-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)(C)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO2/c1-4-10-15-13(17)14(2,3)12(16)11-8-6-5-7-9-11/h5-9,12,16H,4,10H2,1-3H3,(H,15,17) |
| InChIKey | HDLYVGNOHJFHSK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-2,2-dimethyl-3-phenyl-N-propylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2,2-dimethyl-3-phenyl-N-propylpropanamide?
The IUPAC name of 3-hydroxy-2,2-dimethyl-3-phenyl-N-propylpropanamide (CID 44560511) is 3-hydroxy-2,2-dimethyl-3-phenyl-N-propylpropanamide.
What is the SMILES notation for 3-hydroxy-2,2-dimethyl-3-phenyl-N-propylpropanamide?
The canonical SMILES for 3-hydroxy-2,2-dimethyl-3-phenyl-N-propylpropanamide is CCCNC(=O)C(C)(C)C(O)c1ccccc1.
What is the InChIKey of 3-hydroxy-2,2-dimethyl-3-phenyl-N-propylpropanamide?
The InChIKey is HDLYVGNOHJFHSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-4-10-15-13(17)14(2,3)12(16)11-8-6-5-7-9-11/h5-9,12,16H,4,10H2,1-3H3,(H,15,17).
What are the key properties of 3-hydroxy-2,2-dimethyl-3-phenyl-N-propylpropanamide?
3-hydroxy-2,2-dimethyl-3-phenyl-N-propylpropanamide has a molecular weight of 235.33 g/mol, XLogP of 2.27, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,2-dimethyl-3-phenyl-N-propylpropanamide is sourced from PubChem (CID 44560511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).